CAS 138835-16-2 appears in our catalog under these names: (E)-3-(3-(Benzyloxy)phenyl)acrylic acid, 98%, (E)-3-(3-(Benzyloxy)phenyl)acrylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 25g, 10g.
(E)-3-(3-phenylmethoxyphenyl)prop-2-enoic acid (CAS 138835-16-2) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: (E)-3-(3-phenylmethoxyphenyl)prop-2-enoic acid. InChIKey: OFMOWGZEBJKDCT-MDZDMXLPSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (E)-3-(3-phenylmethoxyphenyl)prop-2-enoic acid |
| InChIKey | OFMOWGZEBJKDCT-MDZDMXLPSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)