CAS 122066-43-7 appears in our catalog under these names: 1,3-Adamantanediol dimethacrylate, 95%, Adamantane-1,3-diyl bis(2-methylacrylate), 95%, 95%, 3-[(2-methylprop-2-enoyl)oxy]adamantan-1-yl 2-methylprop-2-enoate, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
[3-(2-methylprop-2-enoyloxy)-1-adamantyl] 2-methylprop-2-enoate (CAS 122066-43-7) is a chemical compound with the molecular formula C18H24O4 and a molecular weight of 304.4 g/mol. IUPAC name: [3-(2-methylprop-2-enoyloxy)-1-adamantyl] 2-methylprop-2-enoate. InChIKey: LWZDPKCUTBVCGX-UHFFFAOYSA-N.
| Molecular formula | C18H24O4 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | [3-(2-methylprop-2-enoyloxy)-1-adamantyl] 2-methylprop-2-enoate |
| InChIKey | LWZDPKCUTBVCGX-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC12CC3CC(C1)CC(C3)(C2)OC(=O)C(=C)C |
Computed by PubChem (NCBI)