Products 26057-02-3
CAS 26057-02-3 is the registry number for Trisporic Acid B. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1,3-dimethyl-2-[(1E,3E)-3-methyl-7-oxoocta-1,3-dienyl]-4-oxocyclohex-2-ene-1-carboxylic acid (CAS 26057-02-3) is a chemical compound with the molecular formula C18H24O4 and a molecular weight of 304.4 g/mol. IUPAC name: (1S)-1,3-dimethyl-2-[(1E,3E)-3-methyl-7-oxoocta-1,3-dienyl]-4-oxocyclohex-2-ene-1-carboxylic acid. InChIKey: AUOKEERYXZUYBN-YEOBPPCSSA-N.
| Molecular formula | C18H24O4 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | (1S)-1,3-dimethyl-2-[(1E,3E)-3-methyl-7-oxoocta-1,3-dienyl]-4-oxocyclohex-2-ene-1-carboxylic acid |
| InChIKey | AUOKEERYXZUYBN-YEOBPPCSSA-N |
| SMILES | CC1=C([C@@](CCC1=O)(C)C(=O)O)/C=C/C(=C/CCC(=O)C)/C |
Computed by PubChem (NCBI)
Synonyms:
Trisporic acid B