CAS 33744-74-0 is the registry number for (-)-Mono-(1r)-menthyl phthalate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylbenzoic acid (CAS 33744-74-0) is a chemical compound with the molecular formula C18H24O4 and a molecular weight of 304.4 g/mol. IUPAC name: 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylbenzoic acid. InChIKey: LJFJPDHXAWVDSA-DVOMOZLQSA-N.
| Molecular formula | C18H24O4 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxycarbonylbenzoic acid |
| InChIKey | LJFJPDHXAWVDSA-DVOMOZLQSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)C2=CC=CC=C2C(=O)O)C(C)C |
Computed by PubChem (NCBI)