Products 1220695-06-6

CAS 1220695-06-6 appears in our catalog under these names: Cyclobutylmethanesulfonyl chloride, 95%, Cyclobutylmethanesulfonyl chloride, Cyclobutylmethanesulfonyl chloride, Cyclobutylmethanesulfonyl chloride 95%, Cyclobutylmethanesulfonyl chloride, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.

Structural formula: {0} (CAS {1})

Cyclobutylmethanesulfonyl chloride (CAS 1220695-06-6) is a chemical compound with the molecular formula C5H9ClO2S and a molecular weight of 168.64 g/mol. IUPAC name: cyclobutylmethanesulfonyl chloride. InChIKey: PWKSOBWFPCITKW-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClO2S
Molecular weight168.64 g/mol
IUPAC namecyclobutylmethanesulfonyl chloride
InChIKeyPWKSOBWFPCITKW-UHFFFAOYSA-N
SMILESC1CC(C1)CS(=O)(=O)Cl

Computed by PubChem (NCBI)