Products 2167113-18-8

CAS 2167113-18-8 appears in our catalog under these names: 2,2-Dimethylcyclopropane-1-sulfonyl chloride, 98%, 2,2-Dimethylcyclopropane-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

2,2-dimethylcyclopropane-1-sulfonyl chloride (CAS 2167113-18-8) is a chemical compound with the molecular formula C5H9ClO2S and a molecular weight of 168.64 g/mol. IUPAC name: 2,2-dimethylcyclopropane-1-sulfonyl chloride. InChIKey: XRMNKROTRKJNLT-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClO2S
Molecular weight168.64 g/mol
IUPAC name2,2-dimethylcyclopropane-1-sulfonyl chloride
InChIKeyXRMNKROTRKJNLT-UHFFFAOYSA-N
SMILESCC1(CC1S(=O)(=O)Cl)C

Computed by PubChem (NCBI)