Products 1314903-62-2

CAS 1314903-62-2 appears in our catalog under these names: (1-Methylcyclopropyl)methanesulfonyl chloride, 97%, (1-methylcyclopropyl)methanesulfonyl chloride, 95%, 95%, (1-METHYLCYCLOPROPYL)METHANESULFONYL CHLORIDE, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.

(1-methylcyclopropyl)methanesulfonyl chloride (CAS 1314903-62-2) is a chemical compound with the molecular formula C5H9ClO2S and a molecular weight of 168.64 g/mol. IUPAC name: (1-methylcyclopropyl)methanesulfonyl chloride. InChIKey: NPUZLDVCLQJVNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClO2S
Molecular weight168.64 g/mol
IUPAC name(1-methylcyclopropyl)methanesulfonyl chloride
InChIKeyNPUZLDVCLQJVNQ-UHFFFAOYSA-N
SMILESCC1(CC1)CS(=O)(=O)Cl

Computed by PubChem (NCBI)