CAS 1221177-84-9 appears in our catalog under these names: 4,6-Dichloro-9h-pyrimido[4,5-b]indole, 95%, 4,6-Dichloro-9H-pyrimido(4,5-b)indole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
4,6-dichloro-9H-pyrimido[4,5-b]indole (CAS 1221177-84-9) is a chemical compound with the molecular formula C10H5Cl2N3 and a molecular weight of 238.07 g/mol. IUPAC name: 4,6-dichloro-9H-pyrimido[4,5-b]indole. InChIKey: DVHDVRMZBIAUIN-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2N3 |
|---|---|
| Molecular weight | 238.07 g/mol |
| IUPAC name | 4,6-dichloro-9H-pyrimido[4,5-b]indole |
| InChIKey | DVHDVRMZBIAUIN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C3=C(N2)N=CN=C3Cl |
Computed by PubChem (NCBI)