CAS 2886735-32-4 is the registry number for 5,8-Dichloroimidazo[1,5-a]quinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,8-dichloroimidazo[1,5-a]quinazoline (CAS 2886735-32-4) is a chemical compound with the molecular formula C10H5Cl2N3 and a molecular weight of 238.07 g/mol. IUPAC name: 5,8-dichloroimidazo[1,5-a]quinazoline. InChIKey: VQHJOACXESNADR-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2N3 |
|---|---|
| Molecular weight | 238.07 g/mol |
| IUPAC name | 5,8-dichloroimidazo[1,5-a]quinazoline |
| InChIKey | VQHJOACXESNADR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N3C=NC=C3N=C2Cl |
Computed by PubChem (NCBI)