CAS 42265-25-8 is the registry number for (((3,5-dichlorophenyl)amino)methylene)methane-1,1-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(3,5-dichloroanilino)methylidene]propanedinitrile (CAS 42265-25-8) is a chemical compound with the molecular formula C10H5Cl2N3 and a molecular weight of 238.07 g/mol. IUPAC name: 2-[(3,5-dichloroanilino)methylidene]propanedinitrile. InChIKey: VYVLXCBTKLOFKO-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2N3 |
|---|---|
| Molecular weight | 238.07 g/mol |
| IUPAC name | 2-[(3,5-dichloroanilino)methylidene]propanedinitrile |
| InChIKey | VYVLXCBTKLOFKO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)NC=C(C#N)C#N |
Computed by PubChem (NCBI)