CAS 1334331-43-9 appears in our catalog under these names: 4,8-Dichloroimidazo(1,5-a)quinoxaline, 95%, 4,8-Dichloroimidazo(1,5-a)quinoxaline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
4,8-dichloroimidazo[1,5-a]quinoxaline (CAS 1334331-43-9) is a chemical compound with the molecular formula C10H5Cl2N3 and a molecular weight of 238.07 g/mol. IUPAC name: 4,8-dichloroimidazo[1,5-a]quinoxaline. InChIKey: QQFSCGYTBDYLSG-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2N3 |
|---|---|
| Molecular weight | 238.07 g/mol |
| IUPAC name | 4,8-dichloroimidazo[1,5-a]quinoxaline |
| InChIKey | QQFSCGYTBDYLSG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N3C=NC=C3C(=N2)Cl |
Computed by PubChem (NCBI)