CAS 1221256-00-3 appears in our catalog under these names: 4-(2,2,2-Trifluoroethyl)-4h-thieno(3,2-b)pyrrole-5-carboxylic acid, 95%, 4-(2,2,2-Trifluoroethyl)-4H-thieno(3,2-b)pyrrole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-(2,2,2-trifluoroethyl)thieno[3,2-b]pyrrole-5-carboxylic acid (CAS 1221256-00-3) is a chemical compound with the molecular formula C9H6F3NO2S and a molecular weight of 249.21 g/mol. IUPAC name: 4-(2,2,2-trifluoroethyl)thieno[3,2-b]pyrrole-5-carboxylic acid. InChIKey: HITCJGHIRRMKFC-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO2S |
|---|---|
| Molecular weight | 249.21 g/mol |
| IUPAC name | 4-(2,2,2-trifluoroethyl)thieno[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | HITCJGHIRRMKFC-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1N(C(=C2)C(=O)O)CC(F)(F)F |
Computed by PubChem (NCBI)