CAS 1820707-54-7 is the registry number for 3-Amino-6-(trifluoromethyl)-1-benzothiophene-1,1-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1,1-dioxo-6-(trifluoromethyl)-1-benzothiophen-3-amine (CAS 1820707-54-7) is a chemical compound with the molecular formula C9H6F3NO2S and a molecular weight of 249.21 g/mol. IUPAC name: 1,1-dioxo-6-(trifluoromethyl)-1-benzothiophen-3-amine. InChIKey: VCGFKAHCDACNDM-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO2S |
|---|---|
| Molecular weight | 249.21 g/mol |
| IUPAC name | 1,1-dioxo-6-(trifluoromethyl)-1-benzothiophen-3-amine |
| InChIKey | VCGFKAHCDACNDM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)S(=O)(=O)C=C2N |
Computed by PubChem (NCBI)