CAS 1383827-77-7 is the registry number for 2-Methanesulfonyl-4-(trifluoromethyl)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
2-methylsulfonyl-4-(trifluoromethyl)benzonitrile (CAS 1383827-77-7) is a chemical compound with the molecular formula C9H6F3NO2S and a molecular weight of 249.21 g/mol. IUPAC name: 2-methylsulfonyl-4-(trifluoromethyl)benzonitrile. InChIKey: HGLJZCFSFNCPHL-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO2S |
|---|---|
| Molecular weight | 249.21 g/mol |
| IUPAC name | 2-methylsulfonyl-4-(trifluoromethyl)benzonitrile |
| InChIKey | HGLJZCFSFNCPHL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)C(F)(F)F)C#N |
Computed by PubChem (NCBI)