Products 1221272-94-1
CAS 1221272-94-1 is the registry number for 1-Nitro-4-(2,2,2-trifluoro-1-methyl-ethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-nitro-4-(1,1,1-trifluoropropan-2-yl)benzene (CAS 1221272-94-1) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 1-nitro-4-(1,1,1-trifluoropropan-2-yl)benzene. InChIKey: NEEBNUPDRJLNCP-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 1-nitro-4-(1,1,1-trifluoropropan-2-yl)benzene |
| InChIKey | NEEBNUPDRJLNCP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)