Products 122139-97-3
CAS 122139-97-3 appears in our catalog under these names: 2-(Trifluoromethyl)-1,3-benzoxazol-5-amine, 95%, 2-(Trifluoromethyl)-1,3-benzoxazol-5-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 100mg, 1g.
2-(trifluoromethyl)-1,3-benzoxazol-5-amine (CAS 122139-97-3) is a chemical compound with the molecular formula C8H5F3N2O and a molecular weight of 202.13 g/mol. IUPAC name: 2-(trifluoromethyl)-1,3-benzoxazol-5-amine. InChIKey: FLWWHTTZBXDGEQ-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,3-benzoxazol-5-amine |
| InChIKey | FLWWHTTZBXDGEQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)N=C(O2)C(F)(F)F |
Computed by PubChem (NCBI)