Products 12217-86-6
CAS 12217-86-6 is the registry number for Disperse red 54, AR, AR. Offered by: Chemat. Available pack sizes: 5g, 25g, 100g, 500g.
Methyl 3-[4-(2-chloro-4-nitrophenyl)-N-(2-cyanoethyl)-2-diazenylanilino]propanoate (CAS 12217-86-6) is a chemical compound with the molecular formula C19H18ClN5O4 and a molecular weight of 415.8 g/mol. IUPAC name: methyl 3-[4-(2-chloro-4-nitrophenyl)-N-(2-cyanoethyl)-2-diazenylanilino]propanoate. InChIKey: CXYXKQKTRQTLGU-UHFFFAOYSA-N.
| Molecular formula | C19H18ClN5O4 |
|---|---|
| Molecular weight | 415.8 g/mol |
| IUPAC name | methyl 3-[4-(2-chloro-4-nitrophenyl)-N-(2-cyanoethyl)-2-diazenylanilino]propanoate |
| InChIKey | CXYXKQKTRQTLGU-UHFFFAOYSA-N |
| SMILES | COC(=O)CCN(CCC#N)C1=C(C=C(C=C1)C2=C(C=C(C=C2)[N+](=O)[O-])Cl)N=N |
Computed by PubChem (NCBI)