Products 2205125-60-4
CAS 2205125-60-4 is the registry number for Prolyl Hydroxylase inhibitor 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[5-[1-[3-(4-chlorophenyl)propyl]triazol-4-yl]-3-hydroxypyridine-2-carbonyl]amino]acetic acid (CAS 2205125-60-4) is a chemical compound with the molecular formula C19H18ClN5O4 and a molecular weight of 415.8 g/mol. IUPAC name: 2-[[5-[1-[3-(4-chlorophenyl)propyl]triazol-4-yl]-3-hydroxypyridine-2-carbonyl]amino]acetic acid. InChIKey: RODNKCMKPZCZKG-UHFFFAOYSA-N.
| Molecular formula | C19H18ClN5O4 |
|---|---|
| Molecular weight | 415.8 g/mol |
| IUPAC name | 2-[[5-[1-[3-(4-chlorophenyl)propyl]triazol-4-yl]-3-hydroxypyridine-2-carbonyl]amino]acetic acid |
| InChIKey | RODNKCMKPZCZKG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCCN2C=C(N=N2)C3=CC(=C(N=C3)C(=O)NCC(=O)O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
Prolyl Hydroxylase inhibitor 1, orb1708806