Products 1308257-47-7
CAS 1308257-47-7 appears in our catalog under these names: WM–662, WM-662, 99.48%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mM (in 1ml dmso), 10mM/1mL, 5 mg, 25 mg, 10 mg.
(2S)-2-[(2S)-3-[4-(3-chlorophenyl)phenyl]-1-oxo-1-(2H-tetrazol-5-ylamino)propan-2-yl]oxypropanoic acid (CAS 1308257-47-7) is a chemical compound with the molecular formula C19H18ClN5O4 and a molecular weight of 415.8 g/mol. IUPAC name: (2S)-2-[(2S)-3-[4-(3-chlorophenyl)phenyl]-1-oxo-1-(2H-tetrazol-5-ylamino)propan-2-yl]oxypropanoic acid. InChIKey: YSQNVTHQOQFUOS-ZBEGNZNMSA-N.
| Molecular formula | C19H18ClN5O4 |
|---|---|
| Molecular weight | 415.8 g/mol |
| IUPAC name | (2S)-2-[(2S)-3-[4-(3-chlorophenyl)phenyl]-1-oxo-1-(2H-tetrazol-5-ylamino)propan-2-yl]oxypropanoic acid |
| InChIKey | YSQNVTHQOQFUOS-ZBEGNZNMSA-N |
| SMILES | C[C@@H](C(=O)O)O[C@@H](CC1=CC=C(C=C1)C2=CC(=CC=C2)Cl)C(=O)NC3=NNN=N3 |
Computed by PubChem (NCBI)