Products 6657-37-0
CAS 6657-37-0 is the registry number for C.I. Disperse red 54. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 3-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-(2-cyanoethyl)anilino]propanoate (CAS 6657-37-0) is a chemical compound with the molecular formula C19H18ClN5O4 and a molecular weight of 415.8 g/mol. IUPAC name: methyl 3-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-(2-cyanoethyl)anilino]propanoate. InChIKey: BMUXKUVOASOJKR-UHFFFAOYSA-N.
| Molecular formula | C19H18ClN5O4 |
|---|---|
| Molecular weight | 415.8 g/mol |
| IUPAC name | methyl 3-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-(2-cyanoethyl)anilino]propanoate |
| InChIKey | BMUXKUVOASOJKR-UHFFFAOYSA-N |
| SMILES | COC(=O)CCN(CCC#N)C1=CC=C(C=C1)N=NC2=C(C=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)