CAS 1221722-69-5 appears in our catalog under these names: 3,3,3-Trifluoro-1-(piperazin-1-yl)propan-1-one hydrochloride, 98%, 3,3,3-Trifluoro-1-(piperazin-1-yl)propan-1-one hydrochloride, 3,3,3-Trifluoro-1-(piperazin-1-yl)propan-1-one hydrochloride, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 10g, 50mg, 0,5g, 100mg, 250mg, 500mg, 1g.
3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one;hydrochloride (CAS 1221722-69-5) is a chemical compound with the molecular formula C7H12ClF3N2O and a molecular weight of 232.63 g/mol. IUPAC name: 3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one;hydrochloride. InChIKey: VSAYMYVJEZKLEG-UHFFFAOYSA-N.
| Molecular formula | C7H12ClF3N2O |
|---|---|
| Molecular weight | 232.63 g/mol |
| IUPAC name | 3,3,3-trifluoro-1-piperazin-1-ylpropan-1-one;hydrochloride |
| InChIKey | VSAYMYVJEZKLEG-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)CC(F)(F)F.Cl |
Computed by PubChem (NCBI)