CAS 1269053-62-4 is the registry number for 1-(Trifluoroacetyl)-1,4-diazepane hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-(1,4-diazepan-1-yl)-2,2,2-trifluoroethanone;hydrochloride (CAS 1269053-62-4) is a chemical compound with the molecular formula C7H12ClF3N2O and a molecular weight of 232.63 g/mol. IUPAC name: 1-(1,4-diazepan-1-yl)-2,2,2-trifluoroethanone;hydrochloride. InChIKey: NPIWCBGRANKIML-UHFFFAOYSA-N.
| Molecular formula | C7H12ClF3N2O |
|---|---|
| Molecular weight | 232.63 g/mol |
| IUPAC name | 1-(1,4-diazepan-1-yl)-2,2,2-trifluoroethanone;hydrochloride |
| InChIKey | NPIWCBGRANKIML-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C(=O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)