CAS 133891-75-5 is the registry number for 2,2,2-Trifluoro-N-((3-methylazetidin-3-yl)methyl)acetamide hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-N-[(3-methylazetidin-3-yl)methyl]acetamide;hydrochloride (CAS 133891-75-5) is a chemical compound with the molecular formula C7H12ClF3N2O and a molecular weight of 232.63 g/mol. IUPAC name: 2,2,2-trifluoro-N-[(3-methylazetidin-3-yl)methyl]acetamide;hydrochloride. InChIKey: VZRKFZDYXONYHR-UHFFFAOYSA-N.
| Molecular formula | C7H12ClF3N2O |
|---|---|
| Molecular weight | 232.63 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-[(3-methylazetidin-3-yl)methyl]acetamide;hydrochloride |
| InChIKey | VZRKFZDYXONYHR-UHFFFAOYSA-N |
| SMILES | CC1(CNC1)CNC(=O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)