Products 1221723-59-6
CAS 1221723-59-6 is the registry number for 6-(Difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 1221723-59-6) is a chemical compound with the molecular formula C11H13F2NO and a molecular weight of 213.22 g/mol. IUPAC name: 6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: FGDTVOVCPPLKHK-UHFFFAOYSA-N.
| Molecular formula | C11H13F2NO |
|---|---|
| Molecular weight | 213.22 g/mol |
| IUPAC name | 6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | FGDTVOVCPPLKHK-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=C(C=C2)OC(F)F)N |
Computed by PubChem (NCBI)