CAS 131401-55-3 is the registry number for N,N-Diethyl-2,5-difluorobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N,N-diethyl-2,5-difluorobenzamide (CAS 131401-55-3) is a chemical compound with the molecular formula C11H13F2NO and a molecular weight of 213.22 g/mol. IUPAC name: N,N-diethyl-2,5-difluorobenzamide. InChIKey: JEEJMEMWBHLCKZ-UHFFFAOYSA-N.
| Molecular formula | C11H13F2NO |
|---|---|
| Molecular weight | 213.22 g/mol |
| IUPAC name | N,N-diethyl-2,5-difluorobenzamide |
| InChIKey | JEEJMEMWBHLCKZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C=CC(=C1)F)F |
Computed by PubChem (NCBI)