CAS 223444-29-9 appears in our catalog under these names: N-(1,1-Dimethylethyl)-3,4-difluorobenzamide, 98%, N-(1,1-Dimethylethyl)-3,4-difluorobenzamide, 95%, 95%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
N-tert-butyl-3,4-difluorobenzamide (CAS 223444-29-9) is a chemical compound with the molecular formula C11H13F2NO and a molecular weight of 213.22 g/mol. IUPAC name: N-tert-butyl-3,4-difluorobenzamide. InChIKey: YSUNDAWBDCFQNI-UHFFFAOYSA-N.
| Molecular formula | C11H13F2NO |
|---|---|
| Molecular weight | 213.22 g/mol |
| IUPAC name | N-tert-butyl-3,4-difluorobenzamide |
| InChIKey | YSUNDAWBDCFQNI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=CC(=C(C=C1)F)F |
Computed by PubChem (NCBI)