Products 1221723-60-9

CAS 1221723-60-9 is the registry number for Ethyl 3-amino-2-(pyridin-3-ylmethyl)propanoate dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g, 1g.

Ethyl 2-(aminomethyl)-3-pyridin-3-ylpropanoate;dihydrochloride (CAS 1221723-60-9) is a chemical compound with the molecular formula C11H18Cl2N2O2 and a molecular weight of 281.18 g/mol. IUPAC name: ethyl 2-(aminomethyl)-3-pyridin-3-ylpropanoate;dihydrochloride. InChIKey: RKEBZTVRFOSNTO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18Cl2N2O2
Molecular weight281.18 g/mol
IUPAC nameethyl 2-(aminomethyl)-3-pyridin-3-ylpropanoate;dihydrochloride
InChIKeyRKEBZTVRFOSNTO-UHFFFAOYSA-N
SMILESCCOC(=O)C(CC1=CN=CC=C1)CN.Cl.Cl

Computed by PubChem (NCBI)