CAS 1260638-12-7 is the registry number for tert–Butyl 2–amino–2–(pyridin–4–yl)acetate dihydrochloride. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
Tert-butyl 2-(pyridin-4-ylamino)acetate;dihydrochloride (CAS 1260638-12-7) is a chemical compound with the molecular formula C11H18Cl2N2O2 and a molecular weight of 281.18 g/mol. IUPAC name: tert-butyl 2-(pyridin-4-ylamino)acetate;dihydrochloride. InChIKey: WEGITFRDKCUXDE-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl2N2O2 |
|---|---|
| Molecular weight | 281.18 g/mol |
| IUPAC name | tert-butyl 2-(pyridin-4-ylamino)acetate;dihydrochloride |
| InChIKey | WEGITFRDKCUXDE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CNC1=CC=NC=C1.Cl.Cl |
Computed by PubChem (NCBI)