Products 1955498-53-9

CAS 1955498-53-9 is the registry number for 2-Amino-3-((1-phenylethyl)amino)propanoic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-amino-3-(1-phenylethylamino)propanoic acid;dihydrochloride (CAS 1955498-53-9) is a chemical compound with the molecular formula C11H18Cl2N2O2 and a molecular weight of 281.18 g/mol. IUPAC name: 2-amino-3-(1-phenylethylamino)propanoic acid;dihydrochloride. InChIKey: DNBPWWNNZHFJTK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18Cl2N2O2
Molecular weight281.18 g/mol
IUPAC name2-amino-3-(1-phenylethylamino)propanoic acid;dihydrochloride
InChIKeyDNBPWWNNZHFJTK-UHFFFAOYSA-N
SMILESCC(C1=CC=CC=C1)NCC(C(=O)O)N.Cl.Cl

Computed by PubChem (NCBI)