Products 1221724-84-0
CAS 1221724-84-0 appears in our catalog under these names: 1,2-Dimethyl-1h-1,3-benzodiazole-5-carboxylic acid hydrochloride, 95%, 1,2-Dimethyl-1H-benzo(d)imidazole-5-carboxylic acid hydrochloride, 95%, 1,2-Dimethyl-1H-1,3-benzodiazole-5-carboxylic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg.
1,2-dimethylbenzimidazole-5-carboxylic acid;hydrochloride (CAS 1221724-84-0) is a chemical compound with the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. IUPAC name: 1,2-dimethylbenzimidazole-5-carboxylic acid;hydrochloride. InChIKey: LFGSEGRPUIJPJD-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O2 |
|---|---|
| Molecular weight | 226.66 g/mol |
| IUPAC name | 1,2-dimethylbenzimidazole-5-carboxylic acid;hydrochloride |
| InChIKey | LFGSEGRPUIJPJD-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C)C=CC(=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)