CAS 1221725-76-3 appears in our catalog under these names: (2-(2H-1,3-Benzodioxol-5-yl)propan-2-yl)(methyl)amine, 95%, (2-(1,3-Dioxaindan-5-yl)propan-2-yl)(methyl)amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(1,3-benzodioxol-5-yl)-N-methylpropan-2-amine (CAS 1221725-76-3) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-N-methylpropan-2-amine. InChIKey: ZQOLNFHGRAXKBK-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-N-methylpropan-2-amine |
| InChIKey | ZQOLNFHGRAXKBK-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC2=C(C=C1)OCO2)NC |
Computed by PubChem (NCBI)