CAS 1221725-81-0 is the registry number for (1-(2-Bromophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[1-(2-bromophenyl)triazol-4-yl]methanamine;hydrochloride (CAS 1221725-81-0) is a chemical compound with the molecular formula C9H10BrClN4 and a molecular weight of 289.56 g/mol. IUPAC name: [1-(2-bromophenyl)triazol-4-yl]methanamine;hydrochloride. InChIKey: SVRUHAPBYWEOMU-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClN4 |
|---|---|
| Molecular weight | 289.56 g/mol |
| IUPAC name | [1-(2-bromophenyl)triazol-4-yl]methanamine;hydrochloride |
| InChIKey | SVRUHAPBYWEOMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=C(N=N2)CN)Br.Cl |
Computed by PubChem (NCBI)