CAS 1240527-78-9 appears in our catalog under these names: (3-(4-Bromophenyl)-1H-1,2,4-triazol-5-yl)methanamine hydrochloride, 95%, (3-(4-Bromophenyl)-1H-1,2,4-triazol-5-yl)methanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
[3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride (CAS 1240527-78-9) is a chemical compound with the molecular formula C9H10BrClN4 and a molecular weight of 289.56 g/mol. IUPAC name: [3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride. InChIKey: NGCSVHKYOODXAM-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClN4 |
|---|---|
| Molecular weight | 289.56 g/mol |
| IUPAC name | [3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride |
| InChIKey | NGCSVHKYOODXAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=N2)CN)Br.Cl |
Computed by PubChem (NCBI)