CAS 2060040-98-2 is the registry number for 3-bromo-1-tert-butyl-4-chloro-1h-pyrazolo[3,4-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-bromo-1-tert-butyl-4-chloropyrazolo[5,4-d]pyrimidine (CAS 2060040-98-2) is a chemical compound with the molecular formula C9H10BrClN4 and a molecular weight of 289.56 g/mol. IUPAC name: 3-bromo-1-tert-butyl-4-chloropyrazolo[5,4-d]pyrimidine. InChIKey: DUBPIPALFZMMRN-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClN4 |
|---|---|
| Molecular weight | 289.56 g/mol |
| IUPAC name | 3-bromo-1-tert-butyl-4-chloropyrazolo[5,4-d]pyrimidine |
| InChIKey | DUBPIPALFZMMRN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=C(C(=NC=N2)Cl)C(=N1)Br |
Computed by PubChem (NCBI)