Products 12221-86-2
CAS 12221-86-2 is the registry number for Basic Yellow 40. Offered by: Chemat. Available pack sizes: 25g.
7-(diethylamino)-3-(1,3-dimethylbenzimidazol-3-ium-2-yl)chromen-2-one chloride (CAS 12221-86-2) is a chemical compound with the molecular formula C22H24ClN3O2 and a molecular weight of 397.9 g/mol. IUPAC name: 7-(diethylamino)-3-(1,3-dimethylbenzimidazol-3-ium-2-yl)chromen-2-one chloride. InChIKey: LCVNGSHJQQOSDB-UHFFFAOYSA-M.
| Molecular formula | C22H24ClN3O2 |
|---|---|
| Molecular weight | 397.9 g/mol |
| IUPAC name | 7-(diethylamino)-3-(1,3-dimethylbenzimidazol-3-ium-2-yl)chromen-2-one chloride |
| InChIKey | LCVNGSHJQQOSDB-UHFFFAOYSA-M |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C3=[N+](C4=CC=CC=C4N3C)C.[Cl-] |
Computed by PubChem (NCBI)