Products 29556-33-0
CAS 29556-33-0 appears in our catalog under these names: Basic Yellow 40, 2-(7-(Diethylamino)-2-oxo-2H-chromen-3-yl)-1,3-dimethyl-1H-benzo[d]imidazol-3-ium chloride. Offered by: TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 5g, 10g, 25g, 50g, 10mg, 100mg, 1g.
7-(diethylamino)-3-(1,3-dimethylbenzimidazol-3-ium-2-yl)chromen-2-one chloride (CAS 29556-33-0) is a chemical compound with the molecular formula C22H24ClN3O2 and a molecular weight of 397.9 g/mol. IUPAC name: 7-(diethylamino)-3-(1,3-dimethylbenzimidazol-3-ium-2-yl)chromen-2-one chloride. InChIKey: LCVNGSHJQQOSDB-UHFFFAOYSA-M.
| Molecular formula | C22H24ClN3O2 |
|---|---|
| Molecular weight | 397.9 g/mol |
| IUPAC name | 7-(diethylamino)-3-(1,3-dimethylbenzimidazol-3-ium-2-yl)chromen-2-one chloride |
| InChIKey | LCVNGSHJQQOSDB-UHFFFAOYSA-M |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C3=[N+](C4=CC=CC=C4N3C)C.[Cl-] |
Computed by PubChem (NCBI)