CAS 1346617-18-2 appears in our catalog under these names: (R)-Azelastine N-Oxide (Mixture of Diastereomers), Azelastine Impurity 4. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg.
4-[(4-chlorophenyl)methyl]-2-[(4R)-1-methyl-1-oxidoazepan-1-ium-4-yl]phthalazin-1-one (CAS 1346617-18-2) is a chemical compound with the molecular formula C22H24ClN3O2 and a molecular weight of 397.9 g/mol. IUPAC name: 4-[(4-chlorophenyl)methyl]-2-[(4R)-1-methyl-1-oxidoazepan-1-ium-4-yl]phthalazin-1-one. InChIKey: QFWLGALGCDUDAP-QOBPCVTDSA-N.
| Molecular formula | C22H24ClN3O2 |
|---|---|
| Molecular weight | 397.9 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)methyl]-2-[(4R)-1-methyl-1-oxidoazepan-1-ium-4-yl]phthalazin-1-one |
| InChIKey | QFWLGALGCDUDAP-QOBPCVTDSA-N |
| SMILES | C[N+]1(CCC[C@H](CC1)N2C(=O)C3=CC=CC=C3C(=N2)CC4=CC=C(C=C4)Cl)[O-] |
Computed by PubChem (NCBI)