CAS 122220-20-6 is the registry number for 4,4'-(Naphthalene-2,6-diylbis(oxy))dianiline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[6-(4-aminophenoxy)naphthalen-2-yl]oxyaniline (CAS 122220-20-6) is a chemical compound with the molecular formula C22H18N2O2 and a molecular weight of 342.4 g/mol. IUPAC name: 4-[6-(4-aminophenoxy)naphthalen-2-yl]oxyaniline. InChIKey: FTBKLDUVEBIPHH-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O2 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 4-[6-(4-aminophenoxy)naphthalen-2-yl]oxyaniline |
| InChIKey | FTBKLDUVEBIPHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=CC3=C(C=C2)C=C(C=C3)OC4=CC=C(C=C4)N |
Computed by PubChem (NCBI)