Products 7248-16-0

CAS 7248-16-0 is the registry number for 2,3-Bis(4-methoxyphenyl)quinoxaline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2,3-bis(4-methoxyphenyl)quinoxaline (CAS 7248-16-0) is a chemical compound with the molecular formula C22H18N2O2 and a molecular weight of 342.4 g/mol. IUPAC name: 2,3-bis(4-methoxyphenyl)quinoxaline. InChIKey: JMLIBSAYWRQXIV-UHFFFAOYSA-N.

Identity
Molecular formulaC22H18N2O2
Molecular weight342.4 g/mol
IUPAC name2,3-bis(4-methoxyphenyl)quinoxaline
InChIKeyJMLIBSAYWRQXIV-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C2=NC3=CC=CC=C3N=C2C4=CC=C(C=C4)OC

Computed by PubChem (NCBI)