CAS 2755-74-0 appears in our catalog under these names: 5-(1,3-Benzodioxol-5-yl)-4,5-dihydro-1,3-diphenylpyrazole, 95%, 5-(1,3-Benzodioxol-5-yl)-4,5-dihydro-1,3-diphenylpyrazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
3-(1,3-benzodioxol-5-yl)-2,5-diphenyl-3,4-dihydropyrazole (CAS 2755-74-0) is a chemical compound with the molecular formula C22H18N2O2 and a molecular weight of 342.4 g/mol. IUPAC name: 3-(1,3-benzodioxol-5-yl)-2,5-diphenyl-3,4-dihydropyrazole. InChIKey: OMXGMDCWDJHQIA-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O2 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 3-(1,3-benzodioxol-5-yl)-2,5-diphenyl-3,4-dihydropyrazole |
| InChIKey | OMXGMDCWDJHQIA-UHFFFAOYSA-N |
| SMILES | C1C(N(N=C1C2=CC=CC=C2)C3=CC=CC=C3)C4=CC5=C(C=C4)OCO5 |
Computed by PubChem (NCBI)