CAS 122225-54-1 appears in our catalog under these names: (2S)-3-azido-2-{((tert-butoxy)carbonyl)amino}propanoic acid, N-tert-butoxycarbonyl-azido-L-alanine, 95%, 95%, cyclohexanaminium (2S)-3-azido-2-{[(tert-butoxy)carbonyl]amino}propanoate, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 10g, 1g, 5g.
(2S)-3-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 122225-54-1) is a chemical compound with the molecular formula C8H14N4O4 and a molecular weight of 230.22 g/mol. IUPAC name: (2S)-3-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KIFVOLVBGXELHT-YFKPBYRVSA-N.
| Molecular formula | C8H14N4O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | (2S)-3-azido-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KIFVOLVBGXELHT-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)