Products 1630044-08-4
CAS 1630044-08-4 is the registry number for N3-D-Dap(Boc)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g, 500mg.
(2R)-2-azido-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1630044-08-4) is a chemical compound with the molecular formula C8H14N4O4 and a molecular weight of 230.22 g/mol. IUPAC name: (2R)-2-azido-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: IVADUQQDYTXXQS-RXMQYKEDSA-N.
| Molecular formula | C8H14N4O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | (2R)-2-azido-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | IVADUQQDYTXXQS-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)