CAS 122243-33-8 appears in our catalog under these names: 2,2,2-Trifluoro-1-(4-(methylthio)phenyl)ethanone, 97%, 97%, 4'-Thiomethyl-2,2,2-trifluoroacetophenone, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
2,2,2-trifluoro-1-(4-methylsulfanylphenyl)ethanone (CAS 122243-33-8) is a chemical compound with the molecular formula C9H7F3OS and a molecular weight of 220.21 g/mol. IUPAC name: 2,2,2-trifluoro-1-(4-methylsulfanylphenyl)ethanone. InChIKey: JCWQTARLYJDDRE-UHFFFAOYSA-N.
| Molecular formula | C9H7F3OS |
|---|---|
| Molecular weight | 220.21 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(4-methylsulfanylphenyl)ethanone |
| InChIKey | JCWQTARLYJDDRE-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)