CAS 75072-07-0 is the registry number for S-(Trifluoroacetyl)-4-mercaptotoluene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
S-(4-methylphenyl) 2,2,2-trifluoroethanethioate (CAS 75072-07-0) is a chemical compound with the molecular formula C9H7F3OS and a molecular weight of 220.21 g/mol. IUPAC name: S-(4-methylphenyl) 2,2,2-trifluoroethanethioate. InChIKey: UTLCXQRJYGDYOK-UHFFFAOYSA-N.
| Molecular formula | C9H7F3OS |
|---|---|
| Molecular weight | 220.21 g/mol |
| IUPAC name | S-(4-methylphenyl) 2,2,2-trifluoroethanethioate |
| InChIKey | UTLCXQRJYGDYOK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)SC(=O)C(F)(F)F |
Computed by PubChem (NCBI)