CAS 56773-33-2 appears in our catalog under these names: 3'-(Trifluoromethylthio)acetophenone, 97%, 1-(3-((Trifluoromethyl)thio)phenyl)ethanone, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
1-[3-(trifluoromethylsulfanyl)phenyl]ethanone (CAS 56773-33-2) is a chemical compound with the molecular formula C9H7F3OS and a molecular weight of 220.21 g/mol. IUPAC name: 1-[3-(trifluoromethylsulfanyl)phenyl]ethanone. InChIKey: UKKYMJZZMADIAV-UHFFFAOYSA-N.
| Molecular formula | C9H7F3OS |
|---|---|
| Molecular weight | 220.21 g/mol |
| IUPAC name | 1-[3-(trifluoromethylsulfanyl)phenyl]ethanone |
| InChIKey | UKKYMJZZMADIAV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)SC(F)(F)F |
Computed by PubChem (NCBI)