CAS 122263-08-5 appears in our catalog under these names: 1-Bromo-4-((nitromethyl)sulfonyl)benzene, ((4-bromophenyl)sulfonyl)nitromethane. Offered by: TRC, Biosynth. Available pack sizes: 1g, 250mg.
1-bromo-4-(nitromethylsulfonyl)benzene (CAS 122263-08-5) is a chemical compound with the molecular formula C7H6BrNO4S and a molecular weight of 280.10 g/mol. IUPAC name: 1-bromo-4-(nitromethylsulfonyl)benzene. InChIKey: XSYSLPHTIRTSIJ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO4S |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 1-bromo-4-(nitromethylsulfonyl)benzene |
| InChIKey | XSYSLPHTIRTSIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)C[N+](=O)[O-])Br |
Computed by PubChem (NCBI)