Products 2995282-97-6
CAS 2995282-97-6 is the registry number for 2-Bromo-4-(methylsulfonyl)-1-nitrobenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-bromo-4-methylsulfonyl-1-nitrobenzene (CAS 2995282-97-6) is a chemical compound with the molecular formula C7H6BrNO4S and a molecular weight of 280.10 g/mol. IUPAC name: 2-bromo-4-methylsulfonyl-1-nitrobenzene. InChIKey: JFCFTSRBHACZAW-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO4S |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 2-bromo-4-methylsulfonyl-1-nitrobenzene |
| InChIKey | JFCFTSRBHACZAW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)