CAS 94832-06-1 appears in our catalog under these names: 1–Bromo–4–(methylsulfonyl)–2–nitrobenzene, 1-Bromo-4-(methylsulfonyl)-2-nitrobenzene 98%, 1-Bromo-4-(methylsulfonyl)-2-nitrobenzene, 97%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
1-bromo-4-methylsulfonyl-2-nitrobenzene (CAS 94832-06-1) is a chemical compound with the molecular formula C7H6BrNO4S and a molecular weight of 280.10 g/mol. IUPAC name: 1-bromo-4-methylsulfonyl-2-nitrobenzene. InChIKey: ZRANEAXTVRBKGK-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO4S |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 1-bromo-4-methylsulfonyl-2-nitrobenzene |
| InChIKey | ZRANEAXTVRBKGK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)