CAS 1223343-03-0 is the registry number for 1-(5-methyl-3-(2-pyridylamino)-2,4-thiazolyl)ethan-1-one, hydrochloride. Offered by: Biosynth. Available pack sizes: 5000mg.
1-[4-methyl-2-(pyridin-1-ium-2-ylamino)-1,3-thiazol-5-yl]ethanone chloride (CAS 1223343-03-0) is a chemical compound with the molecular formula C11H12ClN3OS and a molecular weight of 269.75 g/mol. IUPAC name: 1-[4-methyl-2-(pyridin-1-ium-2-ylamino)-1,3-thiazol-5-yl]ethanone chloride. InChIKey: JGUVYMLMOYABAG-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3OS |
|---|---|
| Molecular weight | 269.75 g/mol |
| IUPAC name | 1-[4-methyl-2-(pyridin-1-ium-2-ylamino)-1,3-thiazol-5-yl]ethanone chloride |
| InChIKey | JGUVYMLMOYABAG-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC2=CC=CC=[NH+]2)C(=O)C.[Cl-] |
Computed by PubChem (NCBI)