CAS 1251924-27-2 is the registry number for N-(4-Cyanophenyl)-1,3-thiazolidine-4-carboxamide hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
N-(4-cyanophenyl)-1,3-thiazolidine-4-carboxamide;hydrochloride (CAS 1251924-27-2) is a chemical compound with the molecular formula C11H12ClN3OS and a molecular weight of 269.75 g/mol. IUPAC name: N-(4-cyanophenyl)-1,3-thiazolidine-4-carboxamide;hydrochloride. InChIKey: NJOXRCXGSCHHND-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3OS |
|---|---|
| Molecular weight | 269.75 g/mol |
| IUPAC name | N-(4-cyanophenyl)-1,3-thiazolidine-4-carboxamide;hydrochloride |
| InChIKey | NJOXRCXGSCHHND-UHFFFAOYSA-N |
| SMILES | C1C(NCS1)C(=O)NC2=CC=C(C=C2)C#N.Cl |
Computed by PubChem (NCBI)